C15H16N4O2 — CID 46581863
N'-(4,6-dimethylpyrimidin-2-yl)-2,3-dihydro-1-benzofuran-5-carbohydrazide (PubChem CID 46581863) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)-2,3-dihydro-1-benzofuran-5-carbohydrazide.
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)-2,3-dihydro-1-benzofuran-5-carbohydrazide |
|---|---|
| PubChem CID | 46581863 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)-2,3-dihydro-1-benzofuran-5-carbohydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)c2ccc3c(c2)CCO3)n1 |
| InChI | InChI=1S/C15H16N4O2/c1-9-7-10(2)17-15(16-9)19-18-14(20)12-3-4-13-11(8-12)5-6-21-13/h3-4,7-8H,5-6H2,1-2H3,(H,18,20)(H,16,17,19) |
| InChIKey | XFTYUBMXTATBSA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|