C13H10O3S — CID 43462591
2,3-dihydro-1,4-benzodioxin-6-yl(thiophen-3-yl)methanone (PubChem CID 43462591) has the molecular formula C13H10O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl(thiophen-3-yl)methanone.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl(thiophen-3-yl)methanone |
|---|---|
| PubChem CID | 43462591 |
| Molecular Formula | C13H10O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl(thiophen-3-yl)methanone |
| SMILES | O=C(c1ccsc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H10O3S/c14-13(10-3-6-17-8-10)9-1-2-11-12(7-9)16-5-4-15-11/h1-3,6-8H,4-5H2 |
| InChIKey | HDGNBRXPBPLFCD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |