C12H10N2O2S — CID 106515242
6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazine-2-thione (PubChem CID 106515242) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazine-2-thione.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazine-2-thione |
|---|---|
| PubChem CID | 106515242 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazine-2-thione |
| SMILES | S=c1cncc(-c2ccc3c(c2)OCCO3)[nH]1 |
| InChI | InChI=1S/C12H10N2O2S/c17-12-7-13-6-9(14-12)8-1-2-10-11(5-8)16-4-3-15-10/h1-2,5-7H,3-4H2,(H,14,17) |
| InChIKey | JFGMXYBPVQDHEG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|