C17H14N2O4 — CID 143969673
2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen (PubChem CID 143969673) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen.
| Compound Name | 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen |
|---|---|
| PubChem CID | 143969673 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen |
| SMILES | [H][H].c1cc2c(cc1-c1cnc(-c3ccc4c(c3)OCO4)[nH]1)OCO2 |
| InChI | InChI=1S/C17H12N2O4.H2/c1-3-13-15(22-8-20-13)5-10(1)12-7-18-17(19-12)11-2-4-14-16(6-11)23-9-21-14;/h1-7H,8-9H2,(H,18,19);1H |
| InChIKey | NRTDBXKDJHCTNP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |