2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen

C17H14N2O4 — CID 143969673

IUPAC2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen
SMILES[H][H].c1cc2c(cc1-c1cnc(-c3ccc4c(c3)OCO4)[nH]1)OCO2
InChIInChI=1S/C17H12N2O4.H2/c1-3-13-15(22-8-20-13)5-10(1)12-7-18-17(19-12)11-2-4-14-16(6-11)23-9-21-14;/h1-7H,8-9H2,(H,18,19);1H
InChIKeyNRTDBXKDJHCTNP-UHFFFAOYSA-N
MW310.31 g/mol
LogP3.45
Rot. Bonds2

About 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen

2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen (PubChem CID 143969673) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen.

Molecular Properties

Compound Name2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen
PubChem CID143969673
Molecular FormulaC17H14N2O4
Molecular Weight310.31 g/mol
Exact Mass310.10
IUPAC Name2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen
SMILES[H][H].c1cc2c(cc1-c1cnc(-c3ccc4c(c3)OCO4)[nH]1)OCO2
InChIInChI=1S/C17H12N2O4.H2/c1-3-13-15(22-8-20-13)5-10(1)12-7-18-17(19-12)11-2-4-14-16(6-11)23-9-21-14;/h1-7H,8-9H2,(H,18,19);1H
InChIKeyNRTDBXKDJHCTNP-UHFFFAOYSA-N
XLogP3.45
TPSA65.60 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.31
LogP ≤ 53.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen?
The IUPAC name of 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen (CID 143969673) is 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen.
What is the SMILES notation for 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen?
The canonical SMILES for 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen is [H][H].c1cc2c(cc1-c1cnc(-c3ccc4c(c3)OCO4)[nH]1)OCO2.
What is the InChIKey of 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen?
The InChIKey is NRTDBXKDJHCTNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O4.H2/c1-3-13-15(22-8-20-13)5-10(1)12-7-18-17(19-12)11-2-4-14-16(6-11)23-9-21-14;/h1-7H,8-9H2,(H,18,19);1H.
What are the key properties of 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen?
2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen has a molecular weight of 310.31 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(1,3-benzodioxol-5-yl)-1H-imidazole;molecular hydrogen is sourced from PubChem (CID 143969673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).