C12H11N3O4 — CID 70628448
methyl N-[5-(1,3-benzodioxol-5-yl)-1H-imidazol-2-yl]carbamate (PubChem CID 70628448) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is methyl N-[5-(1,3-benzodioxol-5-yl)-1H-imidazol-2-yl]carbamate.
| Compound Name | methyl N-[5-(1,3-benzodioxol-5-yl)-1H-imidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 70628448 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | methyl N-[5-(1,3-benzodioxol-5-yl)-1H-imidazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1ncc(-c2ccc3c(c2)OCO3)[nH]1 |
| InChI | InChI=1S/C12H11N3O4/c1-17-12(16)15-11-13-5-8(14-11)7-2-3-9-10(4-7)19-6-18-9/h2-5H,6H2,1H3,(H2,13,14,15,16) |
| InChIKey | VDGQDKJSULXACY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |