C17H15N5O3 — CID 135329823
1-[3-(2-amino-1H-imidazol-5-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea (PubChem CID 135329823) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is 1-[3-(2-amino-1H-imidazol-5-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea.
| Compound Name | 1-[3-(2-amino-1H-imidazol-5-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea |
|---|---|
| PubChem CID | 135329823 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-[3-(2-amino-1H-imidazol-5-yl)phenyl]-3-(1,3-benzodioxol-5-yl)urea |
| SMILES | Nc1ncc(-c2cccc(NC(=O)Nc3ccc4c(c3)OCO4)c2)[nH]1 |
| InChI | InChI=1S/C17H15N5O3/c18-16-19-8-13(22-16)10-2-1-3-11(6-10)20-17(23)21-12-4-5-14-15(7-12)25-9-24-14/h1-8H,9H2,(H3,18,19,22)(H2,20,21,23) |
| InChIKey | KJKZOCOFECWIOC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |