C14H14N2O2S — CID 106515251
6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethyl-1H-pyrimidine-4-thione (PubChem CID 106515251) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethyl-1H-pyrimidine-4-thione.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106515251 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethyl-1H-pyrimidine-4-thione |
| SMILES | CCc1nc(=S)cc(-c2ccc3c(c2)OCCO3)[nH]1 |
| InChI | InChI=1S/C14H14N2O2S/c1-2-13-15-10(8-14(19)16-13)9-3-4-11-12(7-9)18-6-5-17-11/h3-4,7-8H,2,5-6H2,1H3,(H,15,16,19) |
| InChIKey | VWQWKEGBQKVCBK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|