C11H8N2O3S — CID 801338
6-(1,3-benzodioxol-5-yl)-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 801338) has the molecular formula C11H8N2O3S and a molecular weight of 248.26 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 801338 |
| Molecular Formula | C11H8N2O3S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | O=c1cc(-c2ccc3c(c2)OCO3)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C11H8N2O3S/c14-10-4-7(12-11(17)13-10)6-1-2-8-9(3-6)16-5-15-8/h1-4H,5H2,(H2,12,13,14,17) |
| InChIKey | WXZICBQKQFDCBI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|