C16H11NO2S2 — CID 21409062
4-(1,3-benzodioxol-5-yl)-5-phenyl-3H-1,3-thiazole-2-thione (PubChem CID 21409062) has the molecular formula C16H11NO2S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-5-phenyl-3H-1,3-thiazole-2-thione.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-5-phenyl-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 21409062 |
| Molecular Formula | C16H11NO2S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-5-phenyl-3H-1,3-thiazole-2-thione |
| SMILES | S=c1[nH]c(-c2ccc3c(c2)OCO3)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H11NO2S2/c20-16-17-14(15(21-16)10-4-2-1-3-5-10)11-6-7-12-13(8-11)19-9-18-12/h1-8H,9H2,(H,17,20) |
| InChIKey | SSXDSRGMFHKBKM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|