C16H10ClNO3S — CID 21408852
4-(1,3-benzodioxol-5-yl)-5-(3-chlorophenyl)-3H-1,3-oxazole-2-thione (PubChem CID 21408852) has the molecular formula C16H10ClNO3S and a molecular weight of 331.78 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-5-(3-chlorophenyl)-3H-1,3-oxazole-2-thione.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-5-(3-chlorophenyl)-3H-1,3-oxazole-2-thione |
|---|---|
| PubChem CID | 21408852 |
| Molecular Formula | C16H10ClNO3S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-5-(3-chlorophenyl)-3H-1,3-oxazole-2-thione |
| SMILES | S=c1[nH]c(-c2ccc3c(c2)OCO3)c(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C16H10ClNO3S/c17-11-3-1-2-10(6-11)15-14(18-16(22)21-15)9-4-5-12-13(7-9)20-8-19-12/h1-7H,8H2,(H,18,22) |
| InChIKey | SDDPACFPROTRIP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|