About 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione
4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione (PubChem CID 21408355) has the molecular formula C17H14ClNO3S
and a molecular weight of 347.82 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione |
| PubChem CID | 21408355 |
| Molecular Formula | C17H14ClNO3S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione |
| SMILES | COc1ccc(-c2oc(=S)[nH]c2-c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C17H14ClNO3S/c1-20-13-8-5-11(9-14(13)21-2)16-15(19-17(23)22-16)10-3-6-12(18)7-4-10/h3-9H,1-2H3,(H,19,23) |
| InChIKey | XWHLPYGZQGVTAT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 47.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione?
The IUPAC name of 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione (CID 21408355) is 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione.
What is the SMILES notation for 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione?
The canonical SMILES for 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione is COc1ccc(-c2oc(=S)[nH]c2-c2ccc(Cl)cc2)cc1OC.
What is the InChIKey of 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione?
The InChIKey is XWHLPYGZQGVTAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClNO3S/c1-20-13-8-5-11(9-14(13)21-2)16-15(19-17(23)22-16)10-3-6-12(18)7-4-10/h3-9H,1-2H3,(H,19,23).
What are the key properties of 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione?
4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione has a molecular weight of 347.82 g/mol, XLogP of 5.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-3H-1,3-oxazole-2-thione is sourced from PubChem (CID 21408355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).