C12H9Cl2NO4 — CID 45118060
3,5-dichloro-6-(3,4-dimethoxyphenyl)-1,4-oxazin-2-one (PubChem CID 45118060) has the molecular formula C12H9Cl2NO4 and a molecular weight of 302.11 g/mol. Its IUPAC name is 3,5-dichloro-6-(3,4-dimethoxyphenyl)-1,4-oxazin-2-one.
| Compound Name | 3,5-dichloro-6-(3,4-dimethoxyphenyl)-1,4-oxazin-2-one |
|---|---|
| PubChem CID | 45118060 |
| Molecular Formula | C12H9Cl2NO4 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 3,5-dichloro-6-(3,4-dimethoxyphenyl)-1,4-oxazin-2-one |
| SMILES | COc1ccc(-c2oc(=O)c(Cl)nc2Cl)cc1OC |
| InChI | InChI=1S/C12H9Cl2NO4/c1-17-7-4-3-6(5-8(7)18-2)9-10(13)15-11(14)12(16)19-9/h3-5H,1-2H3 |
| InChIKey | NIDKULRBXVNXPB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |