About 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one
2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one (PubChem CID 2905734) has the molecular formula C18H13Cl2NO4
and a molecular weight of 378.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one.
Molecular Properties
| Compound Name | 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one |
| PubChem CID | 2905734 |
| Molecular Formula | C18H13Cl2NO4 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one |
| SMILES | COc1ccc(-c2cc(=O)oc(-c3ccc(Cl)cc3Cl)n2)cc1OC |
| InChI | InChI=1S/C18H13Cl2NO4/c1-23-15-6-3-10(7-16(15)24-2)14-9-17(22)25-18(21-14)12-5-4-11(19)8-13(12)20/h3-9H,1-2H3 |
| InChIKey | KUHPELQSBNETPI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one?
The IUPAC name of 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one (CID 2905734) is 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one.
What is the SMILES notation for 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one?
The canonical SMILES for 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one is COc1ccc(-c2cc(=O)oc(-c3ccc(Cl)cc3Cl)n2)cc1OC.
What is the InChIKey of 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one?
The InChIKey is KUHPELQSBNETPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2NO4/c1-23-15-6-3-10(7-16(15)24-2)14-9-17(22)25-18(21-14)12-5-4-11(19)8-13(12)20/h3-9H,1-2H3.
What are the key properties of 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one?
2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one has a molecular weight of 378.21 g/mol, XLogP of 4.69, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenyl)-4-(3,4-dimethoxyphenyl)-1,3-oxazin-6-one is sourced from PubChem (CID 2905734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).