C13H9Cl3O — CID 70266325
2,4-dichloro-1-(4-chloro-2-methoxyphenyl)benzene (PubChem CID 70266325) has the molecular formula C13H9Cl3O and a molecular weight of 287.57 g/mol. Its IUPAC name is 2,4-dichloro-1-(4-chloro-2-methoxyphenyl)benzene.
| Compound Name | 2,4-dichloro-1-(4-chloro-2-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 70266325 |
| Molecular Formula | C13H9Cl3O |
| Molecular Weight | 287.57 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 2,4-dichloro-1-(4-chloro-2-methoxyphenyl)benzene |
| SMILES | COc1cc(Cl)ccc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H9Cl3O/c1-17-13-7-9(15)3-5-11(13)10-4-2-8(14)6-12(10)16/h2-7H,1H3 |
| InChIKey | DJOULLKBJIVOGT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |