C12H8Cl3NO — CID 133088213
5-chloro-3-(2,4-dichlorophenyl)-2-methoxypyridine (PubChem CID 133088213) has the molecular formula C12H8Cl3NO and a molecular weight of 288.56 g/mol. Its IUPAC name is 5-chloro-3-(2,4-dichlorophenyl)-2-methoxypyridine.
| Compound Name | 5-chloro-3-(2,4-dichlorophenyl)-2-methoxypyridine |
|---|---|
| PubChem CID | 133088213 |
| Molecular Formula | C12H8Cl3NO |
| Molecular Weight | 288.56 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 5-chloro-3-(2,4-dichlorophenyl)-2-methoxypyridine |
| SMILES | COc1ncc(Cl)cc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl3NO/c1-17-12-10(4-8(14)6-16-12)9-3-2-7(13)5-11(9)15/h2-6H,1H3 |
| InChIKey | KHGPCWZSOYGSEG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |