C12H7Cl4NO — CID 134635816
5-chloro-2-methoxy-3-(2,4,6-trichlorophenyl)pyridine (PubChem CID 134635816) has the molecular formula C12H7Cl4NO and a molecular weight of 323.01 g/mol. Its IUPAC name is 5-chloro-2-methoxy-3-(2,4,6-trichlorophenyl)pyridine.
| Compound Name | 5-chloro-2-methoxy-3-(2,4,6-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 134635816 |
| Molecular Formula | C12H7Cl4NO |
| Molecular Weight | 323.01 g/mol |
| Exact Mass | 320.93 |
| IUPAC Name | 5-chloro-2-methoxy-3-(2,4,6-trichlorophenyl)pyridine |
| SMILES | COc1ncc(Cl)cc1-c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl4NO/c1-18-12-8(2-7(14)5-17-12)11-9(15)3-6(13)4-10(11)16/h2-5H,1H3 |
| InChIKey | UUEFTHKAFDWQIV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.01 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |