C14H10Cl2O3 — CID 22633197
2-(2,4-dichlorophenyl)-4-hydroxy-5-methoxybenzaldehyde (PubChem CID 22633197) has the molecular formula C14H10Cl2O3 and a molecular weight of 297.14 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-hydroxy-5-methoxybenzaldehyde.
| Compound Name | 2-(2,4-dichlorophenyl)-4-hydroxy-5-methoxybenzaldehyde |
|---|---|
| PubChem CID | 22633197 |
| Molecular Formula | C14H10Cl2O3 |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-hydroxy-5-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(-c2ccc(Cl)cc2Cl)cc1O |
| InChI | InChI=1S/C14H10Cl2O3/c1-19-14-4-8(7-17)11(6-13(14)18)10-3-2-9(15)5-12(10)16/h2-7,18H,1H3 |
| InChIKey | FFGFSHZHLRZWOK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|