C9H6ClNOS — CID 22425597
5-(3-chlorophenyl)-3H-1,3-oxazole-2-thione (PubChem CID 22425597) has the molecular formula C9H6ClNOS and a molecular weight of 211.67 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3H-1,3-oxazole-2-thione.
| Compound Name | 5-(3-chlorophenyl)-3H-1,3-oxazole-2-thione |
|---|---|
| PubChem CID | 22425597 |
| Molecular Formula | C9H6ClNOS |
| Molecular Weight | 211.67 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | 5-(3-chlorophenyl)-3H-1,3-oxazole-2-thione |
| SMILES | S=c1[nH]cc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C9H6ClNOS/c10-7-3-1-2-6(4-7)8-5-11-9(13)12-8/h1-5H,(H,11,13) |
| InChIKey | DYPSTOZOKMXPCE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.67 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|