C12H11ClO — CID 90397375
5-(3-chlorophenyl)-2,3-dimethylfuran (PubChem CID 90397375) has the molecular formula C12H11ClO and a molecular weight of 206.67 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2,3-dimethylfuran.
| Compound Name | 5-(3-chlorophenyl)-2,3-dimethylfuran |
|---|---|
| PubChem CID | 90397375 |
| Molecular Formula | C12H11ClO |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 5-(3-chlorophenyl)-2,3-dimethylfuran |
| SMILES | Cc1cc(-c2cccc(Cl)c2)oc1C |
| InChI | InChI=1S/C12H11ClO/c1-8-6-12(14-9(8)2)10-4-3-5-11(13)7-10/h3-7H,1-2H3 |
| InChIKey | CKFXOWCOZZAQQG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |