C16H10Cl2N2O2 — CID 132588453
5,6-bis(3-chlorophenyl)-1,4-dihydropyrazine-2,3-dione (PubChem CID 132588453) has the molecular formula C16H10Cl2N2O2 and a molecular weight of 333.17 g/mol. Its IUPAC name is 5,6-bis(3-chlorophenyl)-1,4-dihydropyrazine-2,3-dione.
| Compound Name | 5,6-bis(3-chlorophenyl)-1,4-dihydropyrazine-2,3-dione |
|---|---|
| PubChem CID | 132588453 |
| Molecular Formula | C16H10Cl2N2O2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 5,6-bis(3-chlorophenyl)-1,4-dihydropyrazine-2,3-dione |
| SMILES | O=c1[nH]c(-c2cccc(Cl)c2)c(-c2cccc(Cl)c2)[nH]c1=O |
| InChI | InChI=1S/C16H10Cl2N2O2/c17-11-5-1-3-9(7-11)13-14(20-16(22)15(21)19-13)10-4-2-6-12(18)8-10/h1-8H,(H,19,21)(H,20,22) |
| InChIKey | AMSJQEVTQFFUAW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|