C16H11ClN2O2 — CID 79431425
5-(3-chlorophenyl)-4-hydroxy-2-phenyl-1H-pyrimidin-6-one (PubChem CID 79431425) has the molecular formula C16H11ClN2O2 and a molecular weight of 298.73 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-4-hydroxy-2-phenyl-1H-pyrimidin-6-one.
| Compound Name | 5-(3-chlorophenyl)-4-hydroxy-2-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 79431425 |
| Molecular Formula | C16H11ClN2O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 5-(3-chlorophenyl)-4-hydroxy-2-phenyl-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2ccccc2)nc(O)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H11ClN2O2/c17-12-8-4-7-11(9-12)13-15(20)18-14(19-16(13)21)10-5-2-1-3-6-10/h1-9H,(H2,18,19,20,21) |
| InChIKey | IFWPWMSATCVART-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |