C14H8Cl2N2O2S — CID 79431640
5-(3-chlorophenyl)-2-(5-chlorothiophen-2-yl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 79431640) has the molecular formula C14H8Cl2N2O2S and a molecular weight of 339.20 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2-(5-chlorothiophen-2-yl)-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 5-(3-chlorophenyl)-2-(5-chlorothiophen-2-yl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 79431640 |
| Molecular Formula | C14H8Cl2N2O2S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 5-(3-chlorophenyl)-2-(5-chlorothiophen-2-yl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2ccc(Cl)s2)nc(O)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H8Cl2N2O2S/c15-8-3-1-2-7(6-8)11-13(19)17-12(18-14(11)20)9-4-5-10(16)21-9/h1-6H,(H2,17,18,19,20) |
| InChIKey | RAVNSXVFLFRPLO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |