C13H14ClN3O2 — CID 79440205
2-(1-aminopropan-2-yl)-5-(3-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 79440205) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 2-(1-aminopropan-2-yl)-5-(3-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-(1-aminopropan-2-yl)-5-(3-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 79440205 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-(1-aminopropan-2-yl)-5-(3-chlorophenyl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | CC(CN)c1nc(O)c(-c2cccc(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H14ClN3O2/c1-7(6-15)11-16-12(18)10(13(19)17-11)8-3-2-4-9(14)5-8/h2-5,7H,6,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | FXYCRYITZLCJQU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |