C13H13ClN2O3 — CID 79439793
5-(3-chlorophenyl)-2-(ethoxymethyl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 79439793) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2-(ethoxymethyl)-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 5-(3-chlorophenyl)-2-(ethoxymethyl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 79439793 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-(3-chlorophenyl)-2-(ethoxymethyl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | CCOCc1nc(O)c(-c2cccc(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H13ClN2O3/c1-2-19-7-10-15-12(17)11(13(18)16-10)8-4-3-5-9(14)6-8/h3-6H,2,7H2,1H3,(H2,15,16,17,18) |
| InChIKey | NGZGGNCAJMHCNM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |