C17H13ClN2O — CID 135453967
4-(3-chlorophenyl)-5-methyl-2-phenyl-1H-pyrimidin-6-one (PubChem CID 135453967) has the molecular formula C17H13ClN2O and a molecular weight of 296.76 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-methyl-2-phenyl-1H-pyrimidin-6-one.
| Compound Name | 4-(3-chlorophenyl)-5-methyl-2-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135453967 |
| Molecular Formula | C17H13ClN2O |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-(3-chlorophenyl)-5-methyl-2-phenyl-1H-pyrimidin-6-one |
| SMILES | Cc1c(-c2cccc(Cl)c2)nc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C17H13ClN2O/c1-11-15(13-8-5-9-14(18)10-13)19-16(20-17(11)21)12-6-3-2-4-7-12/h2-10H,1H3,(H,19,20,21) |
| InChIKey | POMKEKJNIBABAW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |