C15H12N4O — CID 135581354
5-methyl-2,4-dipyridin-4-yl-1H-pyrimidin-6-one (PubChem CID 135581354) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is 5-methyl-2,4-dipyridin-4-yl-1H-pyrimidin-6-one.
| Compound Name | 5-methyl-2,4-dipyridin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135581354 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 5-methyl-2,4-dipyridin-4-yl-1H-pyrimidin-6-one |
| SMILES | Cc1c(-c2ccncc2)nc(-c2ccncc2)[nH]c1=O |
| InChI | InChI=1S/C15H12N4O/c1-10-13(11-2-6-16-7-3-11)18-14(19-15(10)20)12-4-8-17-9-5-12/h2-9H,1H3,(H,18,19,20) |
| InChIKey | USVGDJSOXNLVMK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |