C8H6ClN3O — CID 135957060
3-(3-chlorophenyl)-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 135957060) has the molecular formula C8H6ClN3O and a molecular weight of 195.61 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-(3-chlorophenyl)-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 135957060 |
| Molecular Formula | C8H6ClN3O |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 3-(3-chlorophenyl)-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(-c2cccc(Cl)c2)[nH]1 |
| InChI | InChI=1S/C8H6ClN3O/c9-6-3-1-2-5(4-6)7-10-8(13)12-11-7/h1-4H,(H2,10,11,12,13) |
| InChIKey | JUVRBKARTKAMIG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |