C12H9ClN2OS — CID 136509859
2-(3-chlorophenyl)-6,7-dihydro-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 136509859) has the molecular formula C12H9ClN2OS and a molecular weight of 264.74 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-6,7-dihydro-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(3-chlorophenyl)-6,7-dihydro-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136509859 |
| Molecular Formula | C12H9ClN2OS |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 2-(3-chlorophenyl)-6,7-dihydro-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2cccc(Cl)c2)nc2c1SCC2 |
| InChI | InChI=1S/C12H9ClN2OS/c13-8-3-1-2-7(6-8)11-14-9-4-5-17-10(9)12(16)15-11/h1-3,6H,4-5H2,(H,14,15,16) |
| InChIKey | IHYNVPVRRBPSFT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |