C11H7Cl2N5 — CID 24973249
6-chloro-8-(3-chlorophenyl)-7H-purin-2-amine (PubChem CID 24973249) has the molecular formula C11H7Cl2N5 and a molecular weight of 280.12 g/mol. Its IUPAC name is 6-chloro-8-(3-chlorophenyl)-7H-purin-2-amine.
| Compound Name | 6-chloro-8-(3-chlorophenyl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 24973249 |
| Molecular Formula | C11H7Cl2N5 |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 6-chloro-8-(3-chlorophenyl)-7H-purin-2-amine |
| SMILES | Nc1nc(Cl)c2[nH]c(-c3cccc(Cl)c3)nc2n1 |
| InChI | InChI=1S/C11H7Cl2N5/c12-6-3-1-2-5(4-6)9-15-7-8(13)16-11(14)18-10(7)17-9/h1-4H,(H3,14,15,16,17,18) |
| InChIKey | XCCSWJFGYNQBBL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |