C12H6ClF3N4 — CID 24903925
6-chloro-8-[3-(trifluoromethyl)phenyl]-7H-purine (PubChem CID 24903925) has the molecular formula C12H6ClF3N4 and a molecular weight of 298.66 g/mol. Its IUPAC name is 6-chloro-8-[3-(trifluoromethyl)phenyl]-7H-purine.
| Compound Name | 6-chloro-8-[3-(trifluoromethyl)phenyl]-7H-purine |
|---|---|
| PubChem CID | 24903925 |
| Molecular Formula | C12H6ClF3N4 |
| Molecular Weight | 298.66 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 6-chloro-8-[3-(trifluoromethyl)phenyl]-7H-purine |
| SMILES | FC(F)(F)c1cccc(-c2nc3ncnc(Cl)c3[nH]2)c1 |
| InChI | InChI=1S/C12H6ClF3N4/c13-9-8-11(18-5-17-9)20-10(19-8)6-2-1-3-7(4-6)12(14,15)16/h1-5H,(H,17,18,19,20) |
| InChIKey | OASGSCGAQYGQKU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.66 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |