C9H6F3N3S — CID 43164237
5-[3-(trifluoromethyl)phenyl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 43164237) has the molecular formula C9H6F3N3S and a molecular weight of 245.23 g/mol. Its IUPAC name is 5-[3-(trifluoromethyl)phenyl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[3-(trifluoromethyl)phenyl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 43164237 |
| Molecular Formula | C9H6F3N3S |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 5-[3-(trifluoromethyl)phenyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | FC(F)(F)c1cccc(-c2nc(=S)[nH][nH]2)c1 |
| InChI | InChI=1S/C9H6F3N3S/c10-9(11,12)6-3-1-2-5(4-6)7-13-8(16)15-14-7/h1-4H,(H2,13,14,15,16) |
| InChIKey | ZPBAVZYGGPPDGL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|