C10H5F6N3S — CID 2736184
5-[3,5-bis(trifluoromethyl)phenyl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 2736184) has the molecular formula C10H5F6N3S and a molecular weight of 313.23 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2736184 |
| Molecular Formula | C10H5F6N3S |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | FC(F)(F)c1cc(-c2nc(=S)[nH][nH]2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H5F6N3S/c11-9(12,13)5-1-4(7-17-8(20)19-18-7)2-6(3-5)10(14,15)16/h1-3H,(H2,17,18,19,20) |
| InChIKey | LZZXOKHNNFOHDU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|