C9H8ClN3S — CID 63194871
5-(3-chloro-4-methylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 63194871) has the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. Its IUPAC name is 5-(3-chloro-4-methylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(3-chloro-4-methylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 63194871 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 5-(3-chloro-4-methylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(-c2nc(=S)[nH][nH]2)cc1Cl |
| InChI | InChI=1S/C9H8ClN3S/c1-5-2-3-6(4-7(5)10)8-11-9(14)13-12-8/h2-4H,1H3,(H2,11,12,13,14) |
| InChIKey | OONLFLWWBMPXTE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|