C11H10ClN3O2 — CID 106520374
6-(3-chloro-4-methylphenyl)-4-methoxy-1H-1,3,5-triazin-2-one (PubChem CID 106520374) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is 6-(3-chloro-4-methylphenyl)-4-methoxy-1H-1,3,5-triazin-2-one.
| Compound Name | 6-(3-chloro-4-methylphenyl)-4-methoxy-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 106520374 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 6-(3-chloro-4-methylphenyl)-4-methoxy-1H-1,3,5-triazin-2-one |
| SMILES | COc1nc(-c2ccc(C)c(Cl)c2)[nH]c(=O)n1 |
| InChI | InChI=1S/C11H10ClN3O2/c1-6-3-4-7(5-8(6)12)9-13-10(16)15-11(14-9)17-2/h3-5H,1-2H3,(H,13,14,15,16) |
| InChIKey | FBBJALDWAJSTAX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |