C14H15N3O2 — CID 106522452
6-(3-cyclobutylphenyl)-4-methoxy-1H-1,3,5-triazin-2-one (PubChem CID 106522452) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 6-(3-cyclobutylphenyl)-4-methoxy-1H-1,3,5-triazin-2-one.
| Compound Name | 6-(3-cyclobutylphenyl)-4-methoxy-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 106522452 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 6-(3-cyclobutylphenyl)-4-methoxy-1H-1,3,5-triazin-2-one |
| SMILES | COc1nc(-c2cccc(C3CCC3)c2)[nH]c(=O)n1 |
| InChI | InChI=1S/C14H15N3O2/c1-19-14-16-12(15-13(18)17-14)11-7-3-6-10(8-11)9-4-2-5-9/h3,6-9H,2,4-5H2,1H3,(H,15,16,17,18) |
| InChIKey | DALPRLKNFCOQFU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |