C13H16O2 — CID 146179008
6-cyclopentyl-2-methoxycyclohepta-2,4,6-trien-1-one (PubChem CID 146179008) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 6-cyclopentyl-2-methoxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 6-cyclopentyl-2-methoxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 146179008 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 6-cyclopentyl-2-methoxycyclohepta-2,4,6-trien-1-one |
| SMILES | COc1cccc(C2CCCC2)cc1=O |
| InChI | InChI=1S/C13H16O2/c1-15-13-8-4-7-11(9-12(13)14)10-5-2-3-6-10/h4,7-10H,2-3,5-6H2,1H3 |
| InChIKey | UVAVANKRZWEGKL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |