C10H7Cl2N3O2 — CID 106517961
6-(2,4-dichlorophenyl)-4-methoxy-1H-1,3,5-triazin-2-one (PubChem CID 106517961) has the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.09 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-4-methoxy-1H-1,3,5-triazin-2-one.
| Compound Name | 6-(2,4-dichlorophenyl)-4-methoxy-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 106517961 |
| Molecular Formula | C10H7Cl2N3O2 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-4-methoxy-1H-1,3,5-triazin-2-one |
| SMILES | COc1nc(-c2ccc(Cl)cc2Cl)[nH]c(=O)n1 |
| InChI | InChI=1S/C10H7Cl2N3O2/c1-17-10-14-8(13-9(16)15-10)6-3-2-5(11)4-7(6)12/h2-4H,1H3,(H,13,14,15,16) |
| InChIKey | HBZZBYWEKWMQBT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |