C8H6ClN3O2S — CID 107362492
6-(3-chlorothiophen-2-yl)-4-methoxy-1H-1,3,5-triazin-2-one (PubChem CID 107362492) has the molecular formula C8H6ClN3O2S and a molecular weight of 243.67 g/mol. Its IUPAC name is 6-(3-chlorothiophen-2-yl)-4-methoxy-1H-1,3,5-triazin-2-one.
| Compound Name | 6-(3-chlorothiophen-2-yl)-4-methoxy-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 107362492 |
| Molecular Formula | C8H6ClN3O2S |
| Molecular Weight | 243.67 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 6-(3-chlorothiophen-2-yl)-4-methoxy-1H-1,3,5-triazin-2-one |
| SMILES | COc1nc(-c2sccc2Cl)[nH]c(=O)n1 |
| InChI | InChI=1S/C8H6ClN3O2S/c1-14-8-11-6(10-7(13)12-8)5-4(9)2-3-15-5/h2-3H,1H3,(H,10,11,12,13) |
| InChIKey | QFTKZUKOIQUSMG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.67 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |