C28H12F12N2 — CID 23400643
2,9-bis[3,5-bis(trifluoromethyl)phenyl]-1,10-phenanthroline (PubChem CID 23400643) has the molecular formula C28H12F12N2 and a molecular weight of 604.39 g/mol. Its IUPAC name is 2,9-bis[3,5-bis(trifluoromethyl)phenyl]-1,10-phenanthroline.
| Compound Name | 2,9-bis[3,5-bis(trifluoromethyl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 23400643 |
| Molecular Formula | C28H12F12N2 |
| Molecular Weight | 604.39 g/mol |
| Exact Mass | 604.08 |
| IUPAC Name | 2,9-bis[3,5-bis(trifluoromethyl)phenyl]-1,10-phenanthroline |
| SMILES | FC(F)(F)c1cc(-c2ccc3ccc4ccc(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)nc4c3n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H12F12N2/c29-25(30,31)17-7-15(8-18(11-17)26(32,33)34)21-5-3-13-1-2-14-4-6-22(42-24(14)23(13)41-21)16-9-19(27(35,36)37)12-20(10-16)28(38,39)40/h1-12H |
| InChIKey | ATHWJIGYUCDGQW-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.39 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|