C13H8F6N2 — CID 143532720
4-[3,5-bis(trifluoromethyl)phenyl]-2-methylpyrimidine (PubChem CID 143532720) has the molecular formula C13H8F6N2 and a molecular weight of 306.21 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-2-methylpyrimidine.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2-methylpyrimidine |
|---|---|
| PubChem CID | 143532720 |
| Molecular Formula | C13H8F6N2 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2-methylpyrimidine |
| SMILES | Cc1nccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H8F6N2/c1-7-20-3-2-11(21-7)8-4-9(12(14,15)16)6-10(5-8)13(17,18)19/h2-6H,1H3 |
| InChIKey | PQUWORDNWKKNLP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |