C17H9F6N — CID 138972935
3-[3,5-bis(trifluoromethyl)phenyl]isoquinoline (PubChem CID 138972935) has the molecular formula C17H9F6N and a molecular weight of 341.25 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]isoquinoline.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]isoquinoline |
|---|---|
| PubChem CID | 138972935 |
| Molecular Formula | C17H9F6N |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]isoquinoline |
| SMILES | FC(F)(F)c1cc(-c2cc3ccccc3cn2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9F6N/c18-16(19,20)13-5-12(6-14(8-13)17(21,22)23)15-7-10-3-1-2-4-11(10)9-24-15/h1-9H |
| InChIKey | FVUPGUYZFJFPJS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |