About 4-isoquinolin-3-ylphenol;tetrahydrochloride
4-isoquinolin-3-ylphenol;tetrahydrochloride (PubChem CID 140752997) has the molecular formula C15H15Cl4NO
and a molecular weight of 367.10 g/mol. Its IUPAC name is 4-isoquinolin-3-ylphenol;tetrahydrochloride.
Molecular Properties
| Compound Name | 4-isoquinolin-3-ylphenol;tetrahydrochloride |
| PubChem CID | 140752997 |
| Molecular Formula | C15H15Cl4NO |
| Molecular Weight | 367.10 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 4-isoquinolin-3-ylphenol;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.Oc1ccc(-c2cc3ccccc3cn2)cc1 |
| InChI | InChI=1S/C15H11NO.4ClH/c17-14-7-5-11(6-8-14)15-9-12-3-1-2-4-13(12)10-16-15;;;;/h1-10,17H;4*1H |
| InChIKey | XIOQKOSXNYYBLW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.10 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-isoquinolin-3-ylphenol;tetrahydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isoquinolin-3-ylphenol;tetrahydrochloride?
The IUPAC name of 4-isoquinolin-3-ylphenol;tetrahydrochloride (CID 140752997) is 4-isoquinolin-3-ylphenol;tetrahydrochloride.
What is the SMILES notation for 4-isoquinolin-3-ylphenol;tetrahydrochloride?
The canonical SMILES for 4-isoquinolin-3-ylphenol;tetrahydrochloride is Cl.Cl.Cl.Cl.Oc1ccc(-c2cc3ccccc3cn2)cc1.
What is the InChIKey of 4-isoquinolin-3-ylphenol;tetrahydrochloride?
The InChIKey is XIOQKOSXNYYBLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO.4ClH/c17-14-7-5-11(6-8-14)15-9-12-3-1-2-4-13(12)10-16-15;;;;/h1-10,17H;4*1H.
What are the key properties of 4-isoquinolin-3-ylphenol;tetrahydrochloride?
4-isoquinolin-3-ylphenol;tetrahydrochloride has a molecular weight of 367.10 g/mol, XLogP of 5.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isoquinolin-3-ylphenol;tetrahydrochloride is sourced from PubChem (CID 140752997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).