C41H27N5 — CID 122427585
3-[4-[2,6-bis(3-pyridin-2-ylphenyl)pyrimidin-4-yl]phenyl]isoquinoline (PubChem CID 122427585) has the molecular formula C41H27N5 and a molecular weight of 589.70 g/mol. Its IUPAC name is 3-[4-[2,6-bis(3-pyridin-2-ylphenyl)pyrimidin-4-yl]phenyl]isoquinoline.
| Compound Name | 3-[4-[2,6-bis(3-pyridin-2-ylphenyl)pyrimidin-4-yl]phenyl]isoquinoline |
|---|---|
| PubChem CID | 122427585 |
| Molecular Formula | C41H27N5 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 3-[4-[2,6-bis(3-pyridin-2-ylphenyl)pyrimidin-4-yl]phenyl]isoquinoline |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4ccc(-c5cc6ccccc6cn5)cc4)nc(-c4cccc(-c5ccccn5)c4)n3)c2)nc1 |
| InChI | InChI=1S/C41H27N5/c1-2-10-35-27-44-38(25-30(35)9-1)28-17-19-29(20-18-28)39-26-40(33-13-7-11-31(23-33)36-15-3-5-21-42-36)46-41(45-39)34-14-8-12-32(24-34)37-16-4-6-22-43-37/h1-27H |
| InChIKey | QOLNBJDJOKNEET-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |