C48H32N4 — CID 140786454
3-[3-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]isoquinoline (PubChem CID 140786454) has the molecular formula C48H32N4 and a molecular weight of 664.81 g/mol. Its IUPAC name is 3-[3-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]isoquinoline.
| Compound Name | 3-[3-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]isoquinoline |
|---|---|
| PubChem CID | 140786454 |
| Molecular Formula | C48H32N4 |
| Molecular Weight | 664.81 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | 3-[3-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]isoquinoline |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)nc(-c4cccc(-c5cc6ccccc6cn5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C48H32N4/c1-4-13-33(14-5-1)36-23-25-37(26-24-36)46-50-47(40-22-12-21-39(27-40)45-31-38-19-10-11-20-41(38)32-49-45)52-48(51-46)44-29-42(34-15-6-2-7-16-34)28-43(30-44)35-17-8-3-9-18-35/h1-32H |
| InChIKey | FNWIKWDQTXRCCY-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.81 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |