C58H52F2N8 — CID 144987688
3-[3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]isoquinoline;3-[3-(4,6-difluoro-1,3,5-triazin-2-yl)phenyl]isoquinoline;ethane (PubChem CID 144987688) has the molecular formula C58H52F2N8 and a molecular weight of 899.11 g/mol. Its IUPAC name is 3-[3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]isoquinoline;3-[3-(4,6-difluoro-1,3,5-triazin-2-yl)phenyl]isoquinoline;ethane.
| Compound Name | 3-[3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]isoquinoline;3-[3-(4,6-difluoro-1,3,5-triazin-2-yl)phenyl]isoquinoline;ethane |
|---|---|
| PubChem CID | 144987688 |
| Molecular Formula | C58H52F2N8 |
| Molecular Weight | 899.11 g/mol |
| Exact Mass | 898.43 |
| IUPAC Name | 3-[3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]isoquinoline;3-[3-(4,6-difluoro-1,3,5-triazin-2-yl)phenyl]isoquinoline;ethane |
| SMILES | CC.CC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3cccc(-c4cc5ccccc5cn4)c3)n2)cc1.Fc1nc(F)nc(-c2cccc(-c3cc4ccccc4cn3)c2)n1 |
| InChI | InChI=1S/C38H36N4.C18H10F2N4.C2H6/c1-37(2,3)31-18-14-25(15-19-31)34-40-35(26-16-20-32(21-17-26)38(4,5)6)42-36(41-34)29-13-9-12-28(22-29)33-23-27-10-7-8-11-30(27)24-39-33;19-17-22-16(23-18(20)24-17)13-7-3-6-12(8-13)15-9-11-4-1-2-5-14(11)10-21-15;1-2/h7-24H,1-6H3;1-10H;1-2H3 |
| InChIKey | FDNJKVWFHTUXHM-UHFFFAOYSA-N |
| XLogP | 14.74 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.11 |
| LogP ≤ 5 | 14.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |