C11H4F6INO — CID 102974686
4-[3,5-bis(trifluoromethyl)phenyl]-2-iodo-1,3-oxazole (PubChem CID 102974686) has the molecular formula C11H4F6INO and a molecular weight of 407.05 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-2-iodo-1,3-oxazole.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2-iodo-1,3-oxazole |
|---|---|
| PubChem CID | 102974686 |
| Molecular Formula | C11H4F6INO |
| Molecular Weight | 407.05 g/mol |
| Exact Mass | 406.92 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2-iodo-1,3-oxazole |
| SMILES | FC(F)(F)c1cc(-c2coc(I)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H4F6INO/c12-10(13,14)6-1-5(8-4-20-9(18)19-8)2-7(3-6)11(15,16)17/h1-4H |
| InChIKey | HNVXEJBXNOBORA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.05 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|