C9H4F2INO — CID 45139288
4-(3,5-difluorophenyl)-2-iodo-1,3-oxazole (PubChem CID 45139288) has the molecular formula C9H4F2INO and a molecular weight of 307.04 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-2-iodo-1,3-oxazole.
| Compound Name | 4-(3,5-difluorophenyl)-2-iodo-1,3-oxazole |
|---|---|
| PubChem CID | 45139288 |
| Molecular Formula | C9H4F2INO |
| Molecular Weight | 307.04 g/mol |
| Exact Mass | 306.93 |
| IUPAC Name | 4-(3,5-difluorophenyl)-2-iodo-1,3-oxazole |
| SMILES | Fc1cc(F)cc(-c2coc(I)n2)c1 |
| InChI | InChI=1S/C9H4F2INO/c10-6-1-5(2-7(11)3-6)8-4-14-9(12)13-8/h1-4H |
| InChIKey | MBYKVCMLBVDAJJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.04 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|