C27H39NO2 — CID 10070106
(Z)-1-(4-phenyl-1,3-oxazol-2-yl)octadec-9-en-1-one (PubChem CID 10070106) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is (Z)-1-(4-phenyl-1,3-oxazol-2-yl)octadec-9-en-1-one.
| Compound Name | (Z)-1-(4-phenyl-1,3-oxazol-2-yl)octadec-9-en-1-one |
|---|---|
| PubChem CID | 10070106 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | (Z)-1-(4-phenyl-1,3-oxazol-2-yl)octadec-9-en-1-one |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)c1nc(-c2ccccc2)co1 |
| InChI | InChI=1S/C27H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-26(29)27-28-25(23-30-27)24-20-17-16-18-21-24/h9-10,16-18,20-21,23H,2-8,11-15,19,22H2,1H3/b10-9- |
| InChIKey | KOOKQMBHKMEODJ-KTKRTIGZSA-N |
| XLogP | 8.56 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|