C12H11F6N3 — CID 142400279
5-[3,5-bis(trifluoromethyl)phenyl]-1H-1,2,4-triazole;ethane (PubChem CID 142400279) has the molecular formula C12H11F6N3 and a molecular weight of 311.23 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-1H-1,2,4-triazole;ethane.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-1H-1,2,4-triazole;ethane |
|---|---|
| PubChem CID | 142400279 |
| Molecular Formula | C12H11F6N3 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-1H-1,2,4-triazole;ethane |
| SMILES | CC.FC(F)(F)c1cc(-c2ncn[nH]2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H5F6N3.C2H6/c11-9(12,13)6-1-5(8-17-4-18-19-8)2-7(3-6)10(14,15)16;1-2/h1-4H,(H,17,18,19);1-2H3 |
| InChIKey | APCHASNGMOPCIU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |