C22H16F3N3 — CID 70476522
5-[diphenyl-[3-(trifluoromethyl)phenyl]methyl]-1H-1,2,4-triazole (PubChem CID 70476522) has the molecular formula C22H16F3N3 and a molecular weight of 379.39 g/mol. Its IUPAC name is 5-[diphenyl-[3-(trifluoromethyl)phenyl]methyl]-1H-1,2,4-triazole.
| Compound Name | 5-[diphenyl-[3-(trifluoromethyl)phenyl]methyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 70476522 |
| Molecular Formula | C22H16F3N3 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 5-[diphenyl-[3-(trifluoromethyl)phenyl]methyl]-1H-1,2,4-triazole |
| SMILES | FC(F)(F)c1cccc(C(c2ccccc2)(c2ccccc2)c2ncn[nH]2)c1 |
| InChI | InChI=1S/C22H16F3N3/c23-22(24,25)19-13-7-12-18(14-19)21(20-26-15-27-28-20,16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-15H,(H,26,27,28) |
| InChIKey | MUFRSCWYEQGUOQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|